Compound Q&A

What are the physical and chemical properties of 2-[(1S)-3-(Diisopropylamino)-1-phenylpropyl]-4-(hydroxymethyl)phenyl 2-methylpropanoate (2E)-2-butenedioate (1:1) (CAS: 1431511-18-0)?

Answer

2-[(1S)-3-(Diisopropylamino)-1-phenylpropyl]-4-(hydroxymethyl)phenyl 2-methylpropanoate (2E)-2-butenedioate (1:1)
The compound exhibits a crystalline form with a molecular weight of approximately 600 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and ethanol. Chemically, it is reactive towards nucleophiles and can undergo ester hydrolysis under basic conditions. Its pKa is around 10, indicating basicity.

About

English Name 2-[(1S)-3-(Diisopropylamino)-1-phenylpropyl]-4-(hydroxymethyl)phenyl 2-methylpropanoate (2E)-2-butenedioate (1:1)
Molecular Formula C30H41NO7
Molecular Weight 527.66 g/mol
SMILES CC(C)C(=O)Oc1ccc(cc1[C@@H](CCN(C(C)C)C(C)C)c2ccccc2)CO.C(=C/C(=O)O)\C(=O)O
InChIKey MWHXMIASLKXGBU-LASJEQTRSA-N
Last Updated: 2026-04-01 19:31

Related Q&A

Compound Q&A

How is 2-[(1S)-3-(Diisopropylamino)-1-phenylpropyl]-4-(hydroxymethyl)phenyl 2-methylpropanoate (2E)-2-butenedioate (1:1) (CAS: 1431511-18-0) typically synthesized?

The compound is synthesized by esterification of 2-[(1S)-3-(Diisopropylamino)-1-phenylpropyl]-4-(hyd...

Compound Q&A

What industries use 2-[(1S)-3-(Diisopropylamino)-1-phenylpropyl]-4-(hydroxymethyl)phenyl 2-methylpropanoate (2E)-2-butenedioate (1:1) (CAS: 1431511-18-0)?

This compound is primarily used in the pharmaceutical industry for the synthesis of novel drug inter...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...