Compound Q&A

What industries use (2E)-3-[4-(Pentyloxy)phenyl]acrylic acid (CAS: 62718-63-2)?

Answer

(2E)-3-[4-(Pentyloxy)phenyl]acrylic acid
(2E)-3-[4-(Pentyloxy)phenyl]acrylic acid is used in various industries, particularly in the pharmaceutical sector for the synthesis of medicinals, in polymer science for the development of novel materials, and in the production of sensors and semiconductors for electronics.

About

CAS No 62718-63-2
English Name (2E)-3-[4-(Pentyloxy)phenyl]acrylic acid
Molecular Formula C14H18O3
Molecular Weight 234.3 g/mol
SMILES CCCCCOc1ccc(cc1)/C=C/C(=O)O
InChIKey WXPBGFBUVHLMSK-JXMROGBWSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-3-[4-(Pentyloxy)phenyl]acrylic acid (CAS: 62718-63-2)?

(2E)-3-[4-(Pentyloxy)phenyl]acrylic acid is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is (2E)-3-[4-(Pentyloxy)phenyl]acrylic acid (CAS: 62718-63-2) typically synthesized?

(2E)-3-[4-(Pentyloxy)phenyl]acrylic acid can be synthesized via a multi-step process involving the p...

Compound Q&A

What precautions should be taken when handling (2E)-3-[4-(Pentyloxy)phenyl]acrylic acid (CAS: 62718-63-2)?

Proper handling of (2E)-3-[4-(Pentyloxy)phenyl]acrylic acid requires the use of personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...