Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate (CAS: 885954-19-8)?

Answer

2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate
2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate has a crystalline form and a molecular weight of approximately 259.36 g/mol. It is slightly soluble in water but highly soluble in organic solvents such as ethanol and acetone. This compound is reactive towards nucleophiles and can undergo hydrolysis under basic conditions. It is also known for its low toxicity and good stability under normal conditions.

About

English Name 2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CC(C)(C)OC(=O)NCCC1CCCCN1
InChIKey FEPKUDZBAUTEMY-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate (CAS: 885954-19-8) typically synthesized?

2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate is typically synthesized via a multistep proce...

Compound Q&A

What industries use 2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate (CAS: 885954-19-8)?

2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate is used in various industries, most notably in...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate (CAS: 885954-19-8)?

When handling 2-Methyl-2-propanyl [2-(2-piperidinyl)ethyl]carbamate, it is important to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...