Compound Q&A

How is 2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5) typically synthesized?

Answer

2,2-Diphenyl-1-propanamine hydrochloride (1:1)
2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5) can be synthesized by the reaction of 2,2-diphenyl-1-propanamine with hydrochloric acid. Commonly, the free amine is dissolved in a suitable solvent like methanol, and hydrochloric acid is added. The reaction is typically carried out at room temperature, with the product isolated by filtration and recrystallization from an appropriate solvent.

About

CAS No 40691-66-5
English Name 2,2-Diphenyl-1-propanamine hydrochloride (1:1)
Molecular Formula C15H18ClN
Molecular Weight 247.77 g/mol
SMILES CC(CN)(C1=CC=CC=C1)C2=CC=CC=C2.Cl
InChIKey AASCJSPDUDWGGQ-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5)?

2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5) is a white crystalline powder. Its molecu...

Compound Q&A

What industries use 2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5)?

2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5) is primarily used in the pharmaceutical a...

Compound Q&A

What precautions should be taken when handling 2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5)?

When handling 2,2-Diphenyl-1-propanamine hydrochloride (CAS: 40691-66-5), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...