Compound Q&A

What are the physical and chemical properties of 2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid (CAS: 78761-37-2)?

Answer

2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid
2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid is a crystalline solid with a molecular weight of approximately 402.26 g/mol. It is slightly soluble in water but soluble in organic solvents. The compound is reactive towards nucleophiles and can undergo hydrolysis. It has a pKa of about 4.5 in aqueous solution.

About

CAS No 78761-37-2
English Name 2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid
Molecular Formula C20H19NO7
Molecular Weight 385.37 g/mol
SMILES CN(C)C(=O)C(C(C(=O)O)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2
InChIKey LINPSOODYGSBAH-UHFFFAOYSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

How is 2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid (CAS: 78761-37-2) typically synthesized?

2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid can be synthesized via a multistep process ...

Compound Q&A

What industries use 2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid (CAS: 78761-37-2)?

2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid (CAS: 78761-37-2)?

Proper handling of 2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid requires the use of pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...