Compound Q&A

How is Zinc Pentamethylenedithiocarbamate (CAS: 13878-54-1) typically synthesized?

Answer

Zinc Pentamethylenedithiocarbamate
Zinc pentamethylenedithiocarbamate is typically synthesized by reacting zinc oxide with dimethyldithiocarbamic acid in the presence of a suitable catalyst under mild conditions. The reaction involves the substitution of zinc for one of the methyl groups in the dithiocarbamate moiety, resulting in the formation of the desired compound with high yield and selectivity.

About

CAS No 13878-54-1
English Name Zinc Pentamethylenedithiocarbamate
Molecular Formula C12H20N2S4Zn
Molecular Weight 386 g/mol
SMILES C1CCN(CC1)C(=S)[S-].C1CCN(CC1)C(=S)[S-].[Zn+2]
InChIKey YBKBEKGVHFHCRI-UHFFFAOYSA-L
Last Updated: 2026-04-01 08:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc Pentamethylenedithiocarbamate (CAS: 13878-54-1)?

Zinc pentamethylenedithiocarbamate (CAS: 13878-54-1) is a colorless or white crystalline powder with...

Compound Q&A

What industries use Zinc Pentamethylenedithiocarbamate (CAS: 13878-54-1)?

Zinc pentamethylenedithiocarbamate (CAS: 13878-54-1) is widely used in the rubber and plastic indust...

Compound Q&A

What precautions should be taken when handling Zinc Pentamethylenedithiocarbamate (CAS: 13878-54-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...