Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl]carbamate (CAS: 1202794-01-1)?

Answer

2-Methyl-2-propanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl]carbamate
2-Methyl-2-propanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl]carbamate is a colorless or slightly yellow liquid with a high molecular weight. It is sparingly soluble in water but soluble in organic solvents. The compound is stable under normal conditions but reacts with strong acids and bases. It has a boiling point of approximately 100-105°C and a density around 1.05 g/cm³.

About

English Name 2-Methyl-2-propanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl]carbamate
Molecular Formula C14H26BNO4
Molecular Weight 283.18 g/mol
SMILES CC(C)(C)OC(=O)NCC(=C)B1OC(C)(C)C(C)(C)O1
InChIKey QACWDBPHSRQMNX-UHFFFAOYSA-N
Last Updated: 2026-04-01 08:55

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl]carbamate (CAS: 1202794-01-1) typically synthesized?

This compound is synthesized via a multistep process involving the reaction of 2-methyl-2-propanol w...

Compound Q&A

What industries use 2-Methyl-2-proanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl]carbamate (CAS: 1202794-01-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl]carbamate (CAS: 1202794-01-1)?

Proper handling of 2-Methyl-2-proanyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-propen-1-yl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...