Compound Q&A

What industries use Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate (CAS: 1041004-63-0)?

Answer

Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate
Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the development of sensors and as a precursor in the semiconductor industry for creating functional materials.

About

English Name Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate
Molecular Formula C10H10N2O3
Molecular Weight 206.201 g/mol
SMILES CCOC(=O)C1=CN2C=CC=C(C2=N1)O
InChIKey UQEMHJITJNMLEM-UHFFFAOYSA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate (CAS: 1041004-63-0)?

Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate is a crystalline compound with a molecular weigh...

Compound Q&A

How is Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate (CAS: 1041004-63-0) typically synthesized?

Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate is typically synthesized through a multi-step pr...

Compound Q&A

What precautions should be taken when handling Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate (CAS: 1041004-63-0)?

When handling Ethyl 8-hydroxyimidazo[1,2-a]pyridine-2-carboxylate, it is important to wear appropria...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...