Compound Q&A

What precautions should be taken when handling 1-Alaninechlamydocin (CAS: 141446-96-0)?

Answer

1-Alaninechlamydocin
Handling 1-Alaninechlamydocin requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately with appropriate absorbents, and the material should be stored in a cool, dry place away from direct sunlight. Safety data sheets (SDS) should be consulted for detailed handling instructions and emergency procedures.

About

English Name 1-Alaninechlamydocin
Molecular Formula C27H36N4O6
Molecular Weight 512.61 g/mol
SMILES CC1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)N1)CCCCCC(=O)C3CO3)CC4=CC=CC=C4
InChIKey QMNUPNOLDLHVTB-IWDBHXEASA-N
Last Updated: 2026-04-01 03:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Alaninechlamydocin (CAS: 141446-96-0)?

1-Alaninechlamydocin is a crystalline compound with a molecular weight of approximately 182.23 g/mol...

Compound Q&A

How is 1-Alaninechlamydocin (CAS: 141446-96-0) typically synthesized?

1-Alaninechlamydocin is synthesized through a multi-step process involving peptide coupling and chla...

Compound Q&A

What industries use 1-Alaninechlamydocin (CAS: 141446-96-0)?

1-Alaninechlamydocin is primarily used in the pharmaceutical industry for its antimicrobial and anti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...