Compound Q&A

How is Cyanamide, cyano-, zinc salt (CAS: 18622-28-1) typically synthesized?

Answer

Cyanamide, cyano-, zinc salt
Cyanamide, cyano-, zinc salt is typically synthesized by reacting zinc nitrate with sodium cyanamide in aqueous solution. The process involves the formation of zinc cyanamide, which is then precipitated and treated with a zinc salt to form the desired zinc salt. The reaction is exothermic and requires appropriate temperature and pH control to achieve high yields and selectivity. Commonly used catalysts include sodium hydroxide or other bases to ensure the reaction proceeds efficiently.

About

CAS No 18622-28-1
English Name Cyanamide, cyano-, zinc salt
Molecular Formula 2[C2N3-].Zn+2
Molecular Weight 197.47 g/mol
SMILES C(=[N-])=NC#N.C(=[N-])=NC#N.[Zn+2]
InChIKey TZBWMAFVBMWFBV-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyanamide, cyano-, zinc salt (CAS: 18622-28-1)?

Cyanamide, cyano-, zinc salt (CAS: 18622-28-1) is a white, crystalline solid with a molecular weight...

Compound Q&A

What industries use Cyanamide, cyano-, zinc salt (CAS: 18622-28-1)?

Cyanamide, cyano-, zinc salt (CAS: 18622-28-1) is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling Cyanamide, cyano-, zinc salt (CAS: 18622-28-1)?

When handling Cyanamide, cyano-, zinc salt (CAS: 18622-28-1), it is important to wear personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...