Compound Q&A

What precautions should be taken when handling N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5)?

Answer

N-(7-Methoxy-1-naphthyl)acetamide
When handling N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5), it is essential to wear appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up immediately using appropriate absorbents, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 93189-18-5
English Name N-(7-Methoxy-1-naphthyl)acetamide
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES CC(=O)NC1=CC=CC2=C1C=C(C=C2)OC
InChIKey ROIBKRTYRRRTPJ-UHFFFAOYSA-N
Last Updated: 2026-03-31 22:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5)?

N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5) is a white crystalline solid with a molecular we...

Compound Q&A

How is N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5) typically synthesized?

N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5) is typically synthesized by the reaction of 7-me...

Compound Q&A

What industries use N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5)?

N-(7-Methoxy-1-naphthyl)acetamide (CAS: 93189-18-5) is primarily used in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...