Compound Q&A

What industries use 2-(4-bromophenyl)triphenylene (CAS: 1158277-56-5)?

Answer

2-(4-broMophenyl)triphenylene
2-(4-bromophenyl)triphenylene (CAS: 1158277-56-5) is used in the pharmaceutical industry for the synthesis of certain drugs due to its unique chemical structure. It is also applied in the polymer industry for developing new materials with specific properties. Additionally, it can be used in semiconductor technology and as a component in sensors.

About

English Name 2-(4-broMophenyl)triphenylene
Molecular Formula C24H15Br
Molecular Weight 383.28 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C=C(C=C3)C4=CC=C(C=C4)Br)C5=CC=CC=C25
InChIKey FWESVNIHRVSDDV-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-bromophenyl)triphenylene (CAS: 1158277-56-5)?

2-(4-bromophenyl)triphenylene (CAS: 1158277-56-5) is a crystalline compound with a high molecular we...

Compound Q&A

How is 2-(4-bromophenyl)triphenylene (CAS: 1158277-56-5) typically synthesized?

2-(4-bromophenyl)triphenylene is typically synthesized via a multistep reaction starting from bromob...

Compound Q&A

What precautions should be taken when handling 2-(4-bromophenyl)triphenylene (CAS: 1158277-56-5)?

When handling 2-(4-bromophenyl)triphenylene (CAS: 1158277-56-5), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...