Compound Q&A

What industries use beta-Alanylhistidine (CAS: 9001-36-9)?

Answer

beta-Alanylhistidine
Beta-Alanylhistidine (CAS: 9001-36-9) is used in various industries. It is particularly important in pharmaceuticals, where it serves as a precursor in the synthesis of certain peptides. Additionally, it is utilized in research for its potential in developing new drug delivery systems and as a component in polymer synthesis and sensor applications.

About

CAS No 9001-36-9
English Name beta-Alanylhistidine
Molecular Formula C9H14N4O3
Molecular Weight 226.24 g/mol
SMILES c1c([nH]cn1)CC(C(=O)O)NC(=O)CCN
InChIKey CQOVPNPJLQNMDC-UHFFFAOYSA-N
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of beta-Alanylhistidine (CAS: 9001-36-9)?

Beta-Alanylhistidine (CAS: 9001-36-9) is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is beta-Alanylhistidine (CAS: 9001-36-9) typically synthesized?

Beta-Alanylhistidine (CAS: 9001-36-9) is typically synthesized through the condensation of L-alanine...

Compound Q&A

What precautions should be taken when handling beta-Alanylhistidine (CAS: 9001-36-9)?

When handling beta-Alanylhistidine (CAS: 9001-36-9), it is important to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...