Compound Q&A

What are the physical and chemical properties of 1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride (CAS: 680622-68-8)?

Answer

1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride
1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride has a crystalline form with a molecular weight of approximately 279.25 g/mol. It is slightly soluble in water and other polar solvents. Chemically, it is reactive towards bases and readily forms complexes with metal ions. It has a low reactivity towards acids and is stable in neutral conditions.

About

English Name 1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride
Molecular Formula C10H15ClN6
Molecular Weight 254.72 g/mol
SMILES C[N+]1(CCCC1)C2=NC(=NC3=C2NC=N3)N.[Cl-]
InChIKey LFEKOSLZZLUSLY-UHFFFAOYSA-M
Last Updated: 2026-03-31 17:51

Related Q&A

Compound Q&A

How is 1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride (CAS: 680622-68-8) typically synthesized?

1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride is typically synthesized through a multi-st...

Compound Q&A

What industries use 1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride (CAS: 680622-68-8)?

1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride (CAS: 680622-68-8)?

When handling 1-(2-Amino-3H-purin-6-yl)-1-methylpyrrolidinium chloride, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...