Compound Q&A

What is 3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 1780970-70-8)?

Answer

3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid
3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid is a chemical compound with a molecular structure that includes a methoxy group, an azetidine ring, and a carboxylic acid group. It is characterized by its specific substituents and functional groups, making it useful in various applications.

About

English Name 3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid
Molecular Formula C10H16NO5-
Molecular Weight 231.25 g/mol
SMILES COC1(CN(C1)C(=O)OC(C)(C)C)C(=O)O
InChIKey RDCWOPRWTAQCRG-UHFFFAOYSA-N
Last Updated: 2026-03-31 12:36

Related Q&A

Compound Q&A

What are the main uses of 3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 1780970-70-8)?

This compound is primarily used in pharmaceuticals and research due to its chemical structure. It ma...

Compound Q&A

Is 3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 1780970-70-8) safe?

3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid is generally considered ...

Compound Q&A

How should 3-Methoxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid (CAS: 1780970-70-8) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...