Compound Q&A

What is 2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1)?

Answer

2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid
2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1) is a colorless or white crystalline solid with a molecular weight of approximately 231.24. It is characterized by its aromatic and thiazole ring structure, making it suitable for various applications in pharmaceuticals and research. The compound is soluble in water and is known for its antioxidant and anti-inflammatory properties.

About

CAS No 72678-82-1
English Name 2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid
Molecular Formula C10H11NO3S
Molecular Weight 225.27 g/mol
SMILES C1C(NC(S1)C2=CC=CC=C2O)C(=O)O
InChIKey APAUAYLVDHNFBF-UHFFFAOYSA-N
Last Updated: 2026-03-31 07:58

Related Q&A

Compound Q&A

What are the main uses of 2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1)?

2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1) is primarily used as a prec...

Compound Q&A

Is 2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1) safe?

2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1) is generally considered saf...

Compound Q&A

How should 2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1) be stored?

2-(2-Hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS: 72678-82-1) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...