Compound Q&A

What are the main uses of 6-Chloro-3-pyridinesulfonic acid (CAS: 17624-08-7)?

Answer

6-Chloro-3-pyridinesulfonic acid
6-Chloro-3-pyridinesulfonic acid is primarily used as a reagent in the synthesis of other compounds, particularly in the pharmaceutical industry. It is also used in research for various chemical reactions and as an intermediate in organic synthesis processes.

About

CAS No 17624-08-7
English Name 6-Chloro-3-pyridinesulfonic acid
Molecular Formula C5H4ClNO3S
Molecular Weight 193.61 g/mol
SMILES C1=CC(=NC=C1S(=O)(=O)O)Cl
InChIKey NWKWBQDPHGDVAI-UHFFFAOYSA-N
Last Updated: 2026-03-31 03:44

Related Q&A

Compound Q&A

What is 6-Chloro-3-pyridinesulfonic acid (CAS: 17624-08-7)?

6-Chloro-3-pyridinesulfonic acid, also known as 3-Chloro-6-pyridinesulfonic acid, is a chemical comp...

Compound Q&A

Is 6-Chloro-3-pyridinesulfonic acid (CAS: 17624-08-7) safe?

6-Chloro-3-pyridinesulfonic acid is generally considered safe for laboratory use when handled with a...

Compound Q&A

How should 6-Chloro-3-pyridinesulfonic acid (CAS: 17624-08-7) be stored?

6-Chloro-3-pyridinesulfonic acid should be stored in a cool, dry place, away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...