Compound Q&A

How should 3-(4-bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1) be stored?

Answer

3-(4-bromo-1H-pyrazol-1-yl)benzoic acid
3-(4-Bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1) should be stored in a cool, dry place away from direct sunlight and moisture. It should be kept in a tightly sealed container to prevent degradation. The storage temperature should be maintained between 15-25°C (59-77°F) to ensure stability. Avoid storing it in high humidity areas to prevent hygroscopic effects.

About

English Name 3-(4-bromo-1H-pyrazol-1-yl)benzoic acid
Molecular Formula C10H7BrN2O2
Molecular Weight 267.08 g/mol
SMILES C1=CC(=CC(=C1)N2C=C(C=N2)Br)C(=O)O
InChIKey YTQYZCOYYUQUKG-UHFFFAOYSA-N
Last Updated: 2026-03-30 20:33

Related Q&A

Compound Q&A

What is 3-(4-bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1)?

3-(4-Bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1) is a chemical compound with a molecular f...

Compound Q&A

What are the main uses of 3-(4-bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1)?

3-(4-Bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1) is primarily used in pharmaceutical resea...

Compound Q&A

Is 3-(4-bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1) safe?

3-(4-Bromo-1H-pyrazol-1-yl)benzoic acid (CAS: 926248-67-1) is generally safe when handled with appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...