Compound Q&A

What are the main uses of 4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7)?

Answer

4-Chloro-1-naphthalenesulfonyl chloride
4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7) is mainly used as an intermediary in the production of dyes and pharmaceuticals. It serves as a key building block in the synthesis of various organic compounds and is also utilized in the textile industry for dyeing purposes.

About

CAS No 64318-08-7
English Name 4-Chloro-1-naphthalenesulfonyl chloride
Molecular Formula C10H6Cl2O2S
Molecular Weight 261.129 g/mol
SMILES Clc1ccc(c2ccccc12)S(=O)(=O)Cl
InChIKey IWWVSFPGXLWBPN-UHFFFAOYSA-N
Last Updated: 2026-03-30 20:33

Related Q&A

Compound Q&A

What is 4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7)?

4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7) is a chemical compound with the molecular ...

Compound Q&A

Is 4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7) safe?

4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7) is generally safe when handled with proper...

Compound Q&A

How should 4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7) be stored?

4-Chloro-1-naphthalenesulfonyl chloride (CAS: 64318-08-7) should be stored in tightly sealed contain...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene