Compound Q&A

What is 8-(Benzyloxy)-7-quinolinecarboxylic acid (CAS: 630414-70-9)?

Answer

8-(Benzyloxy)-7-quinolinecarboxylic acid
8-(Benzyloxy)-7-quinolinecarboxylic acid is an organic compound with the CAS number 630414-70-9. It is a derivative of quinoline and contains a benzyloxy group attached to the 8-position. This compound is used in pharmaceutical research and development, particularly as an intermediate in the synthesis of other compounds.

About

English Name 8-(Benzyloxy)-7-quinolinecarboxylic acid
Molecular Formula C17H13NO3
Molecular Weight 279.29 g/mol
SMILES O=C(C1=CC=C2C=CC=NC2=C1OCC3=CC=CC=C3)O
InChIKey DOCXOUXQNVHBIZ-UHFFFAOYSA-N
Last Updated: 2026-03-30 20:33

Related Q&A

Compound Q&A

What are the main uses of 8-(Benzyloxy)-7-quinolinecarboxylic acid (CAS: 630414-70-9)?

8-(Benzyloxy)-7-quinolinecarboxylic acid is primarily used as an intermediate in the synthesis of ot...

Compound Q&A

Is 8-(Benzyloxy)-7-quinolinecarboxylic acid (CAS: 630414-70-9) safe?

8-(Benzyloxy)-7-quinolinecarboxylic acid is generally safe when handled with appropriate precautions...

Compound Q&A

How should 8-(Benzyloxy)-7-quinolinecarboxylic acid (CAS: 630414-70-9) be stored?

8-(Benzyloxy)-7-quinolinecarboxylic acid should be stored in a cool, dry place, away from direct sun...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...