Compound Q&A

How should 5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside (CAS: 129787-67-3) be stored?

Answer

5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside
5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside should be stored in a cool, dry place away from direct sunlight and high temperatures. It should be kept in a tightly sealed container to prevent degradation or contamination. It is advisable to store it in a refrigerated area to maintain its stability and purity.

About

English Name 5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside
Molecular Formula C14H15BrClNO6
Molecular Weight 408.63 g/mol
SMILES C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br
InChIKey OPIFSICVWOWJMJ-YRSIJOKUSA-N
Last Updated: 2026-03-30 20:33

Related Q&A

Compound Q&A

What is 5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside (CAS: 129787-67-3)?

5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside is a chemical compound with the CAS number 129...

Compound Q&A

What are the main uses of 5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside (CAS: 129787-67-3)?

5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside is primarily used in chemical synthesis as a b...

Compound Q&A

Is 5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside (CAS: 129787-67-3) safe?

5-Bromo-4-chloro-1H-indol-3-yl beta-D-mannopyranoside is generally considered safe for laboratory us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...