Compound Q&A

What is 5-Nitro-3-phenyl-1H-indazole (CAS: 293758-67-5)?

Answer

5-Nitro-3-phenyl-1H-indazole
5-Nitro-3-phenyl-1H-indazole is a chemical compound with the CAS number 293758-67-5. It is a heterocyclic compound with a nitrogen atom in a five-membered ring, featuring a nitro group and a phenyl group attached. The compound is characterized by its aromatic nature and potential use in various applications due to its unique chemical properties.

About

English Name 5-Nitro-3-phenyl-1H-indazole
Molecular Formula C13H9N3O2
Molecular Weight 239.23 g/mol
SMILES C1=CC=C(C=C1)C2=NNC3=C2C=C(C=C3)[N+](=O)[O-]
InChIKey XTLYDYMVKAGVIN-UHFFFAOYSA-N
Last Updated: 2026-03-30 16:28

Related Q&A

Compound Q&A

What are the main uses of 5-Nitro-3-phenyl-1H-indazole (CAS: 293758-67-5)?

5-Nitro-3-phenyl-1H-indazole is primarily used in pharmaceutical research as a potential drug candid...

Compound Q&A

Is 5-Nitro-3-phenyl-1H-indazole (CAS: 293758-67-5) safe?

5-Nitro-3-phenyl-1H-indazole is generally considered safe when handled with proper precautions. Howe...

Compound Q&A

How should 5-Nitro-3-phenyl-1H-indazole (CAS: 293758-67-5) be stored?

5-Nitro-3-phenyl-1H-indazole should be stored in a cool, dry place with a temperature not exceeding ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...