Compound Q&A

What is the market or research trend for 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423032-18-1)?

Answer

2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (1:1)
The market and research trends for 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423032-18-1) are closely tied to its application in pharmaceuticals and materials science. Recent studies have explored its use in the development of pharmaceutical intermediates due to its unique chemical properties. The trend shows increasing interest in its role as a key intermediate in synthetic pathways, particularly in the synthesis of complex organic compounds. Additionally, research into its use in advanced materials, such as catalysts and drug delivery systems, is gaining traction, driven by its potential for enhancing performance and efficiency.

About

English Name 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (1:1)
Molecular Formula C9H11ClF3NO
Molecular Weight 241.63999999999996 g/mol
SMILES OCC(c1ccc(cc1)C(F)(F)F)N.Cl
InChIKey LKRCVAWTGZSLFR-UHFFFAOYSA-N
Last Updated: 2026-03-29 16:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423032-18-1)?

2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423032-18-1) falls under the scope...

Compound Q&A

Are there alternatives to 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423018-18-1) in synthesis?

While 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423032-18-1) is a specific c...

Compound Q&A

How should waste containing 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423032-18-1) be handled?

Waste containing 2-Amino-2-[4-(trifluoromethyl)phenyl]ethanol hydrochloride (CAS: 1423032-18-1) shou...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...