How is N-(5-Chloro-2-pyridinyl)-N'-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-{[(5-methyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridin-2-yl)carbonyl]amino}cyclohexyl]ethanediamide hydrochloride (CAS: 480448-29-1) typically synthesized?

This compound is synthesized through a multi-step process involving the coupling of 5-chloro-2-pyridinecarboxaldehyde with a thiazolo[5,4-c]pyridin-2-ylamine derivative, followed by the addition of dimethylcarbamoyl chloride. The final product is then protonated with hydrochloric acid to form the hydrochloride salt. The reaction conditions include the use of a palladium catalyst and base, with high yield and good selectivity.