Compound Q&A

What are the physical and chemical properties of 2,7-Dimethoxy-3-quinolinecarbaldehyde (CAS: 95395-23-6)?

Answer

2,7-Dimethoxy-3-quinolinecarbaldehyde
2,7-Dimethoxy-3-quinolinecarbaldehyde is a crystalline solid with a molecular weight of approximately 232.22 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is poorly soluble in water. This compound is not highly reactive under normal conditions but can undergo condensation reactions at elevated temperatures. It is stable under acidic and basic conditions but should be stored in a dry environment to prevent hydrolysis.

About

CAS No 95395-23-6
English Name 2,7-Dimethoxy-3-quinolinecarbaldehyde
Molecular Formula C12H11NO3
Molecular Weight 217.22 g/mol
SMILES COC1=CC2=NC(=C(C=C2C=C1)C=O)OC
InChIKey PQECIFGEZCZGSO-UHFFFAOYSA-N
Last Updated: 2026-03-29 12:16

Related Q&A

Compound Q&A

How is 2,7-Dimethoxy-3-quinolinecarbaldehyde (CAS: 95395-23-6) typically synthesized?

2,7-Dimethoxy-3-quinolinecarbaldehyde is typically synthesized via the condensation of 2,7-dimethoxy...

Compound Q&A

What industries use 2,7-Dimethoxy-3-quinolinecarbaldehyde (CAS: 95395-23-6)?

2,7-Dimethoxy-3-quinolinecarbaldehyde is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 2,7-Dimethoxy-3-quinolinecarbaldehyde (CAS: 95395-23-6)?

When handling 2,7-Dimethoxy-3-quinolinecarbaldehyde, it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...