Compound Q&A

What are the physical and chemical properties of (9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene (CAS: 72746-33-9)?

Answer

(9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene
(9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene is a crystalline compound with a molecular weight of approximately 332.45 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. This compound is relatively stable under normal storage conditions but may degrade upon exposure to light and heat. Its reactivity is minimal under standard conditions, making it suitable for various applications.

About

CAS No 72746-33-9
English Name (9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene
Molecular Formula C40H60
Molecular Weight 540.92 g/mol
SMILES CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)CCC=C(C)CCC=C(C)C)C)C)C)C
InChIKey BIWLELKAFXRPDE-ZURBLSRNSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is (9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene (CAS: 72746-33-9) typically synthesized?

(9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene can be synthesized through a multistep process in...

Compound Q&A

What industries use (9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene (CAS: 72746-33-9)?

(9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene finds applications in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene (CAS: 72746-33-9)?

When handling (9cis,9'cis)-7,7',8,8'-Tetrahydro-psi,psi-carotene, it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...