Compound Q&A

What are the physical and chemical properties of N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2)?

Answer

N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride
N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2) is a crystalline compound with a molecular weight of approximately 312.44 g/mol. Its solubility in water is low, around 0.1 g/L at 25°C. The compound is stable under neutral and mild acidic conditions but can react with strong bases. It has a pungent odor and is a weak base.

About

CAS No 16382-06-2
English Name N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride
Molecular Formula C16H25ClN2
Molecular Weight 280.83 g/mol
SMILES CCCN(CCC)CCC1=CNC2=CC=CC=C21.Cl
InChIKey AIAASKTUEVUIQM-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2) typically synthesized?

N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2) can be synthesized by...

Compound Q&A

What industries use N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2)?

N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2) is used in various in...

Compound Q&A

What precautions should be taken when handling N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2)?

When handling N-[2-(1H-Indol-3-yl)ethyl]-N-propyl-1-propanaminium chloride (CAS: 16382-06-2), wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...