Compound Q&A

What are the physical and chemical properties of 4-Methoxylonchocarpin (CAS: 51589-67-4)?

Answer

4-Methoxylonchocarpin
4-Methoxylonchocarpin (CAS: 51589-67-4) is a crystalline compound with a molecular weight of approximately 313.15 g/mol. It has a low solubility in water but good solubility in organic solvents like methanol and ethanol. Chemically, it is relatively stable under normal conditions but can react with strong acids or bases. It has a melting point of about 230-232°C and is often used in pharmaceutical and research applications due to its specific chemical reactivity.

About

CAS No 51589-67-4
English Name 4-Methoxylonchocarpin
Molecular Formula C21H20O4
Molecular Weight 336.4 g/mol
SMILES CC1(C=CC2=C(O1)C=CC(=C2O)C(=O)C=CC3=CC=C(C=C3)OC)C
InChIKey XEVCTBKORYCFCZ-UXBLZVDNSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

How is 4-Methoxylonchocarpin (CAS: 51589-67-4) typically synthesized?

4-Methoxylonchocarpin (CAS: 51589-67-4) is typically synthesized through a multi-step process involv...

Compound Q&A

What industries use 4-Methoxylonchocarpin (CAS: 51589-67-4)?

4-Methoxylonchocarpin (CAS: 51589-67-4) is primarily used in the pharmaceutical industry for the dev...

Compound Q&A

What precautions should be taken when handling 4-Methoxylonchocarpin (CAS: 51589-67-4)?

When handling 4-Methoxylonchocarpin (CAS: 51589-67-4), it is important to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...