Compound Q&A

What industries use 3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid (CAS: 60693-31-4)?

Answer

3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid
3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid is utilized in the pharmaceutical industry for the synthesis of various compounds. It is also used in the development of sensors and semiconductors due to its unique chemical properties. Additionally, it has potential applications in the polymer industry for the modification of polymer properties.

About

CAS No 60693-31-4
English Name 3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid
Molecular Formula C11H9NO4
Molecular Weight 219.2 g/mol
SMILES C1CC(=O)N(C1=O)C2=CC=CC(=C2)C(=O)O
InChIKey BEQRYKGDEGNALQ-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid (CAS: 60693-31-4)?

3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid is a solid crystalline compound with a molecular weight of ...

Compound Q&A

How is 3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid (CAS: 60693-31-4) typically synthesized?

3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid is usually synthesized by the condensation of 2,5-dioxopyrr...

Compound Q&A

What precautions should be taken when handling 3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid (CAS: 60693-31-4)?

When handling 3-(2,5-Dioxopyrrolidin-1-yl)benzoic acid, it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...