Compound Q&A

How is 4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5) typically synthesized?

Answer

4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide
4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5) can be synthesized via the reaction of N,N-dimethylbenzenesulfonamide with formaldehyde in the presence of a basic catalyst such as sodium hydroxide. The synthesis involves condensation and amidation reactions, leading to high yields and good selectivity for the target compound. This process typically requires a fume hood to manage the potential formation of formaldehyde vapor.

About

English Name 4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide
Molecular Formula C9H14N2O2S
Molecular Weight 214.29 g/mol
SMILES CN(C)S(=O)(=O)c1ccc(cc1)CN
InChIKey XSKLMWLTOSBDGW-UHFFFAOYSA-N
Last Updated: 2026-03-28 23:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5)?

4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5) is a white to off-white crystallin...

Compound Q&A

What industries use 4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5)?

4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5) is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5)?

When handling 4-(Aminomethyl)-N,N-dimethylbenzenesulfonamide (CAS: 210918-25-5), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...