Compound Q&A

What precautions should be taken when handling 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid (CAS: 99-23-0)?

Answer

4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid
When handling 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. It should be handled in a fume hood to minimize exposure. In case of a spill, immediate cleanup should be performed using appropriate absorbent materials, and the area should be ventilated. Always refer to the Safety Data Sheet (SDS) for detailed instructions.

About

CAS No 99-23-0
English Name 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid
Molecular Formula C8H6O6
Molecular Weight 198.13 g/mol
SMILES C1=C(C=C(C(=C(C1=O)O)O)O)C(=O)O
InChIKey RRDGXYZZWSIADF-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid (CAS: 99-23-0)?

4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid is a crystalline solid with a molecu...

Compound Q&A

How is 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid (CAS: 99-23-0) typically synthesized?

4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid is synthesized through multi-step re...

Compound Q&A

What industries use 4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid (CAS: 99-23-0)?

4,5,6-Trihydroxy-3-oxo-1,4,6-cycloheptatriene-1-carboxylic acid is primarily used in the pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...