Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9)?

Answer

2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate
When handling 2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The compound should be stored in a cool, dry place, away from direct sunlight and heat sources. In the event of a spill, it should be cleaned up using appropriate chemical spill response procedures, and the area should be well-ventilated. Always refer to the safety data sheet (SDS) for detailed handling instructions.

About

English Name 2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate
Molecular Formula C11H22N2O3S
Molecular Weight 262.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)S(=N)(=O)C
InChIKey VQVKCQUIZRJDBV-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9)?

2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9) is a white...

Compound Q&A

How is 2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9) typically synthesized?

2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9) is typical...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9)?

2-Methyl-2-propanyl 4-(S-methylsulfonimidoyl)-1-piperidinecarboxylate (CAS: 1934513-55-9) is primari...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...