Compound Q&A

What industries use Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

Answer

Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) is used in the pharmaceutical industry for the synthesis of certain agrochemicals and herbicides. It may also be used in the polymer industry for modifying material properties and in the production of sensors and semiconductors for specific applications.

About

CAS No 7084-86-8

English Name Sodium 2-(2,4-dichlorophenoxy)acetate hydrate

Molecular Formula C8H7Cl2NaO4

Molecular Weight 261.0346 g/mol

SMILES C1=CC(=C(C=C1Cl)Cl)OCC(=O)[O-].O.[Na+]

InChIKey LNSAEWXPCBLGDX-UHFFFAOYSA-M

Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) is a crystalline solid with a molecul...

Compound Q&A

How is Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) typically synthesized?

Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) is typically synthesized by reacting ...

Compound Q&A

What precautions should be taken when handling Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

When handling Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8), use appropriate person...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What industries use Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

Answer

About

Related Q&A

What are the physical and chemical properties of Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

How is Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) typically synthesized?

What precautions should be taken when handling Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shanghai Titan Shareholding Technology Co., Ltd.

Shanghai Analytical Rocky Experimental Technology Co., Ltd.

Shanghai Yuyeh Biotechnology Co., Ltd.

Jin Jinle (Hunan) Chemical Co., Ltd.

HuBeiGuoYunFuRui Technology Co Ltd

Shanghai Aladdin Bio-Technologies Co., Ltd.