Compound Q&A

How is Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) typically synthesized?

Answer

Sodium 2-(2,4-dichlorophenoxy)acetate hydrate
Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) is typically synthesized by reacting 2-(2,4-dichlorophenoxy)acetic acid with sodium hydroxide in a suitable solvent. The process requires careful control of pH and temperature to ensure the desired product formation with good yield and selectivity.

About

CAS No 7084-86-8
English Name Sodium 2-(2,4-dichlorophenoxy)acetate hydrate
Molecular Formula C8H7Cl2NaO4
Molecular Weight 261.0346 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)OCC(=O)[O-].O.[Na+]
InChIKey LNSAEWXPCBLGDX-UHFFFAOYSA-M
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) is a crystalline solid with a molecul...

Compound Q&A

What industries use Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8) is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8)?

When handling Sodium 2-(2,4-dichlorophenoxy)acetate hydrate (CAS: 7084-86-8), use appropriate person...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...