Compound Q&A

What precautions should be taken when handling Lipoamido-PEG3-Azide (CAS: 890016-39-4)?

Answer

Lipoamido-PEG3-Azide
When handling Lipoamido-PEG3-Azide (CAS: 890016-39-4), it is important to follow standard safety protocols. Wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Work in a fume hood to minimize exposure to the compound. Store the compound in a cool, dry place away from direct sunlight. In case of spillage, clean up immediately using the appropriate cleaning agents. Always refer to the Safety Data Sheet (SDS) for detailed information on handling and emergency procedures.

About

English Name Lipoamido-PEG3-Azide
Molecular Formula C16H30N4O4S2
Molecular Weight 406.5638 g/mol
SMILES C1CSSC1CCCCC(=O)NCCOCCOCCOCCN=[N+]=[N-]
InChIKey QRVGYUXHOQKUHM-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lipoamido-PEG3-Azide (CAS: 890016-39-4)?

Lipoamido-PEG3-Azide (CAS: 890016-39-4) is a water-soluble compound with a molecular weight of appro...

Compound Q&A

How is Lipoamido-PEG3-Azide (CAS: 890016-39-4) typically synthesized?

Lipoamido-PEG3-Azide (CAS: 890016-39-4) is typically synthesized by conjugating PEG3 with a lipoamid...

Compound Q&A

What industries use Lipoamido-PEG3-Azide (CAS: 890016-39-4)?

Lipoamido-PEG3-Azide (CAS: 890016-39-4) finds applications in various industries due to its unique p...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...