Compound Q&A

What are the physical and chemical properties of 2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4)?

Answer

2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid
2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4) is a crystalline solid with a molecular weight of approximately 556.23 g/mol. It has a melting point of 250-252°C and is poorly soluble in water. It is reactive towards nucleophiles and demonstrates electrophilic aromatic substitution reactivity due to the presence of the triiodo group.

About

CAS No 96-84-4
English Name 2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid
Molecular Formula C11H11I3O3
Molecular Weight 571.92 g/mol
SMILES CCC(CC1=C(C(=C(C=C1I)I)O)I)C(=O)O
InChIKey GOIQOQCNFWYSTQ-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4) typically synthesized?

2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4) is typically synthesized through a mul...

Compound Q&A

What industries use 2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4)?

2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4) is used in pharmaceuticals for the dev...

Compound Q&A

What precautions should be taken when handling 2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4)?

When handling 2-(3-Hydroxy-2,4,6-triiodobenzyl)butanoic acid (CAS: 96-84-4), ensure the use of perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...