Compound Q&A

What precautions should be taken when handling cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0)?

Answer

cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (1:1)
When handling cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0), it is important to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. In case of spills, immediate containment and disposal should follow the safety data sheet (SDS) guidelines. Always refer to the latest SDS for specific handling and storage instructions.

About

English Name cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (1:1)
Molecular Formula C5H9ClF3NO
Molecular Weight 191.57999999999996 g/mol
SMILES Cl.N[C@H]1C[C@](O)(C1)C(F)(F)F
InChIKey ZXWICPXOEHKXJG-AXMBXGHFSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0)?

cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0) is a white to off-whit...

Compound Q&A

How is cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0) typically synthesized?

cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride is typically synthesized by a multistep pr...

Compound Q&A

What industries use cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0)?

cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0) is primarily used in t...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...