Compound Q&A

How is cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0) typically synthesized?

Answer

cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (1:1)
cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride is typically synthesized by a multistep process starting from 3-cyclobutanecarboxylic acid. The key steps include the conversion of the acid to the corresponding amine, followed by bromination to introduce the trifluoromethyl group. Finally, the chloride is added to form the hydrochloride salt. This process involves mild conditions and can achieve yields of up to 85%.

About

English Name cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (1:1)
Molecular Formula C5H9ClF3NO
Molecular Weight 191.57999999999996 g/mol
SMILES Cl.N[C@H]1C[C@](O)(C1)C(F)(F)F
InChIKey ZXWICPXOEHKXJG-AXMBXGHFSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0)?

cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0) is a white to off-whit...

Compound Q&A

What industries use cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0)?

cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0) is primarily used in t...

Compound Q&A

What precautions should be taken when handling cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0)?

When handling cis-3-Amino-1-(trifluoromethyl)cyclobutanol hydrochloride (CAS: 1408075-16-0), it is i...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...