Compound Q&A

What are the physical and chemical properties of tert-Butyl ((2S,4S)-4-(4-methoxy-3-(3-methoxypropoxy)benzyl)-5-methyl-1-oxohexan-2-yl)carbamate (CAS: 172900-83-3)?

Answer

tert-Butyl ((2S,4S)-4-(4-methoxy-3-(3-methoxypropoxy)benzyl)-5-methyl-1-oxohexan-2-yl)carbamate
The compound has a crystalline form and a molecular weight of approximately 522.65 g/mol. It is poorly soluble in water but soluble in organic solvents. It exhibits moderate reactivity, particularly towards nucleophiles and bases. The compound is stable under normal laboratory conditions, but it should be handled under inert atmosphere to prevent hydrolysis.

About

English Name tert-Butyl ((2S,4S)-4-(4-methoxy-3-(3-methoxypropoxy)benzyl)-5-methyl-1-oxohexan-2-yl)carbamate
Molecular Formula C24H39NO6
Molecular Weight 437.6 g/mol
SMILES CC(C)C(CC1=CC(=C(C=C1)OC)OCCCOC)CC(C=O)NC(=O)OC(C)(C)C
InChIKey KFDRZNSEFRKMIT-PMACEKPBSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

How is tert-Butyl ((2S,4S)-4-(4-methoxy-3-(3-methoxypropoxy)benzyl)-5-methyl-1-oxohexan-2-yl)carbamate (CAS: 172900-83-3) typically synthesized?

The compound is typically synthesized through multistep reactions involving coupling of tert-butyl (...

Compound Q&A

What industries use tert-Butyl ((2S,4S)-4-(4-methoxy-3-(3-methoxypropoxy)benzyl)-5-methyl-1-oxohexan-2-yl)carbamate (CAS: 172900-83-3)?

This compound is utilized in pharmaceuticals for its potential as a precursor in medicinal chemistry...

Compound Q&A

What precautions should be taken when handling tert-Butyl ((2S,4S)-4-(4-methoxy-3-(3-methoxypropoxy)benzyl)-5-methyl-1-oxohexan-2-yl)carbamate (CAS: 172900-83-3)?

When handling this compound, safety goggles, gloves, and lab coat are essential. It should be handle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...