Compound Q&A

What are the physical and chemical properties of 1,4,7,10-Tetraazacyclododecane-1-acetic acid, 1,1-dimethylethyl ester (CAS: 137145-75-6)?

Answer

1,4,7,10-Tetraazacyclododecane-1-acetic acid, 1,1-dimethylethyl ester
The compound has a crystalline form and a molecular weight of approximately 314.4 g/mol. It has moderate solubility in common organic solvents. Chemically, it is stable but can react with strong bases. It is a chelating agent and can form coordination complexes with various metal ions.

About

English Name 1,4,7,10-Tetraazacyclododecane-1-acetic acid, 1,1-dimethylethyl ester
Molecular Formula C14H30N4O2
Molecular Weight 286.41 g/mol
SMILES CC(C)(C)OC(=O)CN1CCNCCNCCNCC1
InChIKey CSKOCUPUEKOSOU-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

How is 1,4,7,10-Tetraazacyclododecane-1-acetic acid, 1,1-dimethylethyl ester (CAS: 137145-75-6) typically synthesized?

The compound is typically synthesized through the esterification of 1,4,7,10-tetraazacyclododecane-1...

Compound Q&A

What industries use 1,4,7,10-Tetraazacyclododecane-1-acetic acid, 1,1-dimethylethyl ester (CAS: 137145-75-6)?

This compound is used in pharmaceuticals for metal ion chelation therapy, in polymers as a stabilize...

Compound Q&A

What precautions should be taken when handling 1,4,7,10-Tetraazacyclododecane-1-acetic acid, 1,1-dimethylethyl ester (CAS: 137145-75-6)?

Proper personal protective equipment (PPE) is required, including gloves, goggles, and a lab coat. W...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...