Compound Q&A

Is 2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine (CAS: 352196-01-1) safe?

Answer

2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine
2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine is generally considered safe when handled properly. However, it should be used with caution due to its reactive nature. Protective equipment such as gloves and goggles should be worn. Storage in a cool, dry place away from direct sunlight is recommended to ensure safety.

About

English Name 2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine
Molecular Formula C30H21N9
Molecular Weight 507.55 g/mol
SMILES N1C(C2C([H])=C([H])C([H])=C(C=2[H])N2C([H])=C([H])C([H])=N2)=NC(C2C([H])=C([H])C([H])=C(C=2[H])N2C([H])=C([H])C([H])=N2)=NC=1C1C([H])=C([H])C([H])=C(C=1[H])N1C([H])=C([H])C([H])=N1
InChIKey NZWMBNNEHOHXAE-UHFFFAOYSA-N
Last Updated: 2026-03-27 22:04

Related Q&A

Compound Q&A

What is 2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine (CAS: 352196-01-1)?

2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine is a triazine derivative used in various applic...

Compound Q&A

What are the main uses of 2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine (CAS: 352196-01-1)?

2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine is primarily used in pharmaceuticals as an inte...

Compound Q&A

How should 2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine (CAS: 352196-01-1) be stored?

2,4,6-Tris(3-(1H-pyrazol-1-yl)phenyl)-1,3,5-triazine should be stored in a cool, dry environment, aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...