Compound Q&A

What is 6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine (CAS: 1628264-07-2)?

Answer

6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine
6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine is a chemical compound with the CAS number 1628264-07-2. It is a derivative of imidazo[1,2-a]pyridine containing a bromo and a methyl substitution. It is typically used in research and pharmaceutical applications due to its chemical structure and potential biological activity.

About

English Name 6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine
Molecular Formula C11H14BrN3
Molecular Weight 268.16 g/mol
SMILES CCc1c(n2cc(cc(c2n1)C)Br)NC
InChIKey UJVUQAQBHSQIIB-UHFFFAOYSA-N
Last Updated: 2026-03-27 17:35

Related Q&A

Compound Q&A

What are the main uses of 6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine (CAS: 1628264-07-2)?

The main uses of 6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine include research and deve...

Compound Q&A

Is 6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine (CAS: 1628264-07-2) safe?

6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine is a chemical substance and should be hand...

Compound Q&A

How should 6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine (CAS: 1628264-07-2) be stored?

6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine should be stored in a cool, dry place away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...