Compound Q&A

What are the main uses of Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7)?

Answer

Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate
Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7) is primarily used in research for studying the effects of imidazo[1,2-a]pyridine derivatives on cell proliferation and apoptosis. It may also have potential therapeutic applications in the treatment of certain types of cancer.

About

English Name Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate
Molecular Formula C12H14N2O2
Molecular Weight 218.25 g/mol
SMILES CCOC(=O)c1c(C)nc2n1cccc2C
InChIKey LALYREKEVNEKCM-UHFFFAOYSA-N
Last Updated: 2026-03-27 17:34

Related Q&A

Compound Q&A

What is Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7)?

Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7) is a chemical compound wit...

Compound Q&A

Is Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7) safe?

Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7) is generally considered sa...

Compound Q&A

How should Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7) be stored?

Ethyl 2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CAS: 241146-66-7) should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...