Compound Q&A

Are there alternatives to Dimecrotic acid magnesium salt (CAS: 54283-65-7) in synthesis?

Answer

Dimecrotic acid magnesium salt
While Dimecrotic acid magnesium salt (CAS: 54283-65-7) is a specific compound, there are alternatives in synthesis that can be used based on the desired properties and experimental conditions. Common alternatives include other magnesium salts or acidic compounds that can serve similar functions in the reaction process.

About

CAS No 54283-65-7
English Name Dimecrotic acid magnesium salt
Molecular Formula C24H26MgO8
Molecular Weight 466.8 g/mol
SMILES CC(=CC(=O)[O-])C1=C(C=C(C=C1)OC)OC.CC(=CC(=O)[O-])C1=C(C=C(C=C1)OC)OC.[Mg+2]
InChIKey NRMWCJKNPLZLMY-HIGYRTBYSA-L
Last Updated: 2026-03-27 13:35

Related Q&A

Compound Q&A

What regulatory guidelines apply to Dimecrotic acid magnesium salt (CAS: 54283-65-7)?

Dimecrotic acid magnesium salt (CAS: 54283-65-7) falls under various regulatory guidelines, includin...

Compound Q&A

What is the market or research trend for Dimecrotic acid magnesium salt (CAS: 54283-65-7)?

The market for Dimecrotic acid magnesium salt (CAS: 54283-65-7) is primarily driven by its applicati...

Compound Q&A

How should waste containing Dimecrotic acid magnesium salt (CAS: 54283-65-7) be handled?

Waste containing Dimecrotic acid magnesium salt (CAS: 54283-65-7) should be collected in appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...