Compound Q&A

Are there alternatives to N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-38-7) in synthesis?

Answer

N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride
While N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-38-7) is a specific compound, alternatives such as N-(4-vinylphenyl)methanamine or related amines can serve similar purposes in synthesis. These alternatives can be explored based on specific synthetic requirements and availability.

About

CAS No 7538-38-7
English Name N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride
Molecular Formula C12H18ClN
Molecular Weight 211.73 g/mol
SMILES C[N+](C)(C)CC1=CC=C(C=C1)C=C.[Cl-]
InChIKey TVXNKQRAZONMHJ-UHFFFAOYSA-M
Last Updated: 2026-03-27 02:23

Related Q&A

Compound Q&A

What regulatory guidelines apply to N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-38-7)?

N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-38-7) is subject to various regulato...

Compound Q&A

What is the market or research trend for N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-38-7)?

The market and research trends for N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-3...

Compound Q&A

How should waste containing N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-38-7) be handled?

Waste containing N,N,N-Trimethyl(4-vinylphenyl)methanaminium chloride (CAS: 7538-38-7) should be col...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...