Compound Q&A

What industries use (1,4-Dibenzyl-2-piperazinyl)methanol (CAS: 94437-04-4)?

Answer

(1,4-Dibenzyl-2-piperazinyl)methanol
(1,4-Dibenzyl-2-piperazinyl)methanol finds applications in various industries. In pharmaceuticals, it is used as an intermediate in the synthesis of active pharmaceutical ingredients (APIs). It is also employed in the manufacturing of sensors and electronic devices due to its unique physicochemical properties. Additionally, it has potential uses in the polymer industry for developing novel materials.

About

CAS No 94437-04-4
English Name (1,4-Dibenzyl-2-piperazinyl)methanol
Molecular Formula C19H24N2O
Molecular Weight 296.414 g/mol
SMILES C1CN(C(CN1CC2=CC=CC=C2)CO)CC3=CC=CC=C3
InChIKey SOUPGWGAPDMYFM-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,4-Dibenzyl-2-piperazinyl)methanol (CAS: 94437-04-4)?

(1,4-Dibenzyl-2-piperazinyl)methanol is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

How is (1,4-Dibenzyl-2-piperazinyl)methanol (CAS: 94437-04-4) typically synthesized?

(1,4-Dibenzyl-2-piperazinyl)methanol is commonly synthesized via the reaction of 2-piperazinecarboxy...

Compound Q&A

What precautions should be taken when handling (1,4-Dibenzyl-2-piperazinyl)methanol (CAS: 94437-04-4)?

When handling (1,4-Dibenzyl-2-piperazinyl)methanol, it is essential to follow proper laboratory safe...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...