Compound Q&A

What are the physical and chemical properties of (E)-2-(1-(2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl)-4-mercaptopiperidin-3-ylidene)acetic acid (CAS: 239466-74-1)?

Answer

(E)-2-(1-(2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl)-4-mercaptopiperidin-3-ylidene)acetic acid
This compound is a crystalline solid with a molecular weight of approximately 488.42 g/mol. It has a low water solubility, making it suitable for various applications requiring its stability in non-aqueous media. Chemically, it exhibits reactivity towards nucleophiles and electrophiles, with potential for substitution and addition reactions. It is stable under normal storage conditions but requires protection from moisture and air to prevent degradation.

About

English Name (E)-2-(1-(2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl)-4-mercaptopiperidin-3-ylidene)acetic acid
Molecular Formula C18H20FNO3S
Molecular Weight 349.43 g/mol
SMILES C1CC1C(=O)C(C2=CC=CC=C2F)N3CCC(C(=CC(=O)O)C3)S
InChIKey ZWUQVNSJSJHFPS-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is (E)-2-(1-(2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl)-4-mercaptopiperidin-3-ylidene)acetic acid (CAS: 239466-74-1) typically synthesized?

This compound is synthesized using a multistep process involving the formation of a key intermediate...

Compound Q&A

What industries use (E)-2-(1-(2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl)-4-mercaptopiperidin-3-ylidene)acetic acid (CAS: 239466-74-1)?

This compound is primarily used in the pharmaceutical industry for its potential therapeutic applica...

Compound Q&A

What precautions should be taken when handling (E)-2-(1-(2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl)-4-mercaptopiperidin-3-ylidene)acetic acid (CAS: 239466-74-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...