Compound Q&A

What industries use 2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9)?

Answer

2,4-Dibromo-6-(trifluoromethyl)pyrimidine
2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9) is used in the pharmaceutical industry for the synthesis of biologically active compounds. It also finds applications in the polymer industry for enhancing certain properties of polymers. Additionally, it is used in the development of chemical sensors and as a precursor in semiconductor manufacturing.

About

English Name 2,4-Dibromo-6-(trifluoromethyl)pyrimidine
Molecular Formula C5HBr2F3N2
Molecular Weight 305.87899999999996 g/mol
SMILES C1=C(N=C(N=C1Br)Br)C(F)(F)F
InChIKey QTAAFIZVUMZSPW-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9)?

2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9) is a crystalline solid with a molecular...

Compound Q&A

How is 2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9) typically synthesized?

2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9) is typically synthesized via a multiste...

Compound Q&A

What precautions should be taken when handling 2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9)?

When handling 2,4-Dibromo-6-(trifluoromethyl)pyrimidine (CAS: 785778-00-9), it is crucial to wear ap...

Compound Q&A

What are the main uses of 4-Nitrophenyl phosphate disodium salt hexahydrate (CAS: 333338-18-4)?

4-Nitrophenyl phosphate disodium salt hexahydrate is primarily used as a substra...

333338-18-44-Nitrophenyl phosph...
Compound Q&A

What are the main uses of 2-(Trifluoromethyl)-1,3-oxazole-4-carboxylic Acid (CAS: 1060816-01-4)?

2-(Trifluoromethyl)-1,3-oxazole-4-carboxylic Acid (CAS: 1060816-01-4) is widely ...

1060816-01-42-(Trifluoromethyl)-...
Compound Q&A

How should 2-Fluoro-4-biphenylcarboxylic acid (CAS: 137045-30-8) be stored?

2-Fluoro-4-biphenylcarboxylic acid should be stored in a cool, dry place at room...

137045-30-82-Fluoro-4-biphenylc...
Compound Q&A

What industries use Prednisolone-21-Carboxylic Acid (CAS: 61549-70-0)?

Prednisolone-21-Carboxylic Acid is primarily used in the pharmaceutical industry...

61549-70-0Prednisolone-21-Carb...