Compound Q&A

How should 2-Fluoro-4-biphenylcarboxylic acid (CAS: 137045-30-8) be stored?

Answer

2-Fluoro-4-biphenylcarboxylic acid
2-Fluoro-4-biphenylcarboxylic acid should be stored in a cool, dry place at room temperature, away from direct sunlight and sources of heat. It should be kept in a tightly sealed container to prevent moisture and light exposure.

About

English Name 2-Fluoro-4-biphenylcarboxylic acid
Molecular Formula C13H9FO2
Molecular Weight 216.21 g/mol
SMILES OC(=O)c1ccc(c(F)c1)c2ccccc2
InChIKey PFKITESTTSWHMP-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is 2-Fluoro-4-biphenylcarboxylic acid (CAS: 137045-30-8)?

2-Fluoro-4-biphenylcarboxylic acid is an organic compound with the CAS number 137045-30-8. It is a w...

Compound Q&A

What are the main uses of 2-Fluoro-4-biphenylcarboxylic acid (CAS: 137045-30-8)?

2-Fluoro-4-biphenylcarboxylic acid is primarily used in the synthesis of pharmaceuticals, particular...

Compound Q&A

Is 2-Fluoro-4-biphenylcarboxylic acid (CAS: 137045-30-8) safe?

2-Fluoro-4-biphenylcarboxylic acid is generally considered safe under normal handling conditions. Ho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...