Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8)?

Answer

2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate
2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8) is a crystalline solid with a molecular weight of approximately 220.26 g/mol. It is soluble in organic solvents like methanol and ethanol but has low solubility in water. Chemically, it is reactive towards nucleophiles and can undergo condensation reactions. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate
Molecular Formula C9H13N3O3
Molecular Weight 211.22 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(N1)C=O
InChIKey GCKRKZGUXMRUEU-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8) typically synthesized?

2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8) is typically synthesized...

Compound Q&A

What industries use 2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8)?

2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8) is used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8)?

When handling 2-Methyl-2-propanyl (5-formyl-1H-imidazol-2-yl)carbamate (CAS: 917919-51-8), it is cru...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...